C33H32BrClN4O3S — CID 135791396
cyclohexyl 7-(5-bromo-2-phenylmethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135791396) has the molecular formula C33H32BrClN4O3S and a molecular weight of 680.07 g/mol. Its IUPAC name is cyclohexyl 7-(5-bromo-2-phenylmethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 7-(5-bromo-2-phenylmethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135791396 |
| Molecular Formula | C33H32BrClN4O3S |
| Molecular Weight | 680.07 g/mol |
| Exact Mass | 678.11 |
| IUPAC Name | cyclohexyl 7-(5-bromo-2-phenylmethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OC2CCCCC2)C(c2cc(Br)ccc2OCc2ccccc2)n2nc(SCc3ccccc3Cl)nc2N1 |
| InChI | InChI=1S/C33H32BrClN4O3S/c1-21-29(31(40)42-25-13-6-3-7-14-25)30(26-18-24(34)16-17-28(26)41-19-22-10-4-2-5-11-22)39-32(36-21)37-33(38-39)43-20-23-12-8-9-15-27(23)35/h2,4-5,8-12,15-18,25,30H,3,6-7,13-14,19-20H2,1H3,(H,36,37,38) |
| InChIKey | AQVJIRUYUJQWRW-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.07 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |