C28H30BrClN4O3S — CID 135696063
9-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-ethylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135696063) has the molecular formula C28H30BrClN4O3S and a molecular weight of 618.00 g/mol. Its IUPAC name is 9-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-ethylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-ethylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135696063 |
| Molecular Formula | C28H30BrClN4O3S |
| Molecular Weight | 618.00 g/mol |
| Exact Mass | 616.09 |
| IUPAC Name | 9-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]-2-ethylsulfanyl-6,6-dimethyl-4,5,7,9-tetrahydro-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCC)nn32)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H30BrClN4O3S/c1-5-36-22-12-17(11-19(29)25(22)37-15-16-7-9-18(30)10-8-16)24-23-20(13-28(3,4)14-21(23)35)31-26-32-27(38-6-2)33-34(24)26/h7-12,24H,5-6,13-15H2,1-4H3,(H,31,32,33) |
| InChIKey | LPMOMCLKVSQLPU-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.00 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |