C25H25ClN4O3S — CID 135696125
9-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-2-ethylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135696125) has the molecular formula C25H25ClN4O3S and a molecular weight of 497.02 g/mol. Its IUPAC name is 9-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-2-ethylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-2-ethylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135696125 |
| Molecular Formula | C25H25ClN4O3S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 9-[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]-2-ethylsulfanyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCSc1nc2n(n1)C(c1ccc(OCc3cccc(Cl)c3)c(OC)c1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C25H25ClN4O3S/c1-3-34-25-28-24-27-18-8-5-9-19(31)22(18)23(30(24)29-25)16-10-11-20(21(13-16)32-2)33-14-15-6-4-7-17(26)12-15/h4,6-7,10-13,23H,3,5,8-9,14H2,1-2H3,(H,27,28,29) |
| InChIKey | TZAHRPJAPHOEMP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |