C14H19N5O3 — CID 135697215
2-(2-oxo-2-piperidin-1-ylethyl)-5,6,7,8-tetrahydro-3H-pyrimido[5,4-e][1,4]diazepine-4,9-dione (PubChem CID 135697215) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-(2-oxo-2-piperidin-1-ylethyl)-5,6,7,8-tetrahydro-3H-pyrimido[5,4-e][1,4]diazepine-4,9-dione.
| Compound Name | 2-(2-oxo-2-piperidin-1-ylethyl)-5,6,7,8-tetrahydro-3H-pyrimido[5,4-e][1,4]diazepine-4,9-dione |
|---|---|
| PubChem CID | 135697215 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-(2-oxo-2-piperidin-1-ylethyl)-5,6,7,8-tetrahydro-3H-pyrimido[5,4-e][1,4]diazepine-4,9-dione |
| SMILES | O=C1NCCNc2c1nc(CC(=O)N1CCCCC1)[nH]c2=O |
| InChI | InChI=1S/C14H19N5O3/c20-10(19-6-2-1-3-7-19)8-9-17-12-11(14(22)18-9)15-4-5-16-13(12)21/h15H,1-8H2,(H,16,21)(H,17,18,22) |
| InChIKey | YWNXBVZDBCLWHX-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |