C15H25N5O2 — CID 136737316
(2R)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]-2-(4-methylpiperazin-1-yl)propanamide (PubChem CID 136737316) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is (2R)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]-2-(4-methylpiperazin-1-yl)propanamide.
| Compound Name | (2R)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]-2-(4-methylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 136737316 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (2R)-N-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)ethyl]-2-(4-methylpiperazin-1-yl)propanamide |
| SMILES | Cc1cc(=O)[nH]c(CCNC(=O)[C@@H](C)N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C15H25N5O2/c1-11-10-14(21)18-13(17-11)4-5-16-15(22)12(2)20-8-6-19(3)7-9-20/h10,12H,4-9H2,1-3H3,(H,16,22)(H,17,18,21)/t12-/m1/s1 |
| InChIKey | HTRGFVBGFJIZHH-GFCCVEGCSA-N |
| XLogP | -0.63 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |