C16H12N2O2 — CID 135698723
(Z)-1-phenyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethenol (PubChem CID 135698723) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is (Z)-1-phenyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethenol.
| Compound Name | (Z)-1-phenyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethenol |
|---|---|
| PubChem CID | 135698723 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (Z)-1-phenyl-2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethenol |
| SMILES | O/C(=C\c1nc(-c2ccccc2)no1)c1ccccc1 |
| InChI | InChI=1S/C16H12N2O2/c19-14(12-7-3-1-4-8-12)11-15-17-16(18-20-15)13-9-5-2-6-10-13/h1-11,19H/b14-11- |
| InChIKey | XBBODAYCXLFTEU-KAMYIIQDSA-N |
| XLogP | 3.79 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|