C25H26N6O6 — CID 135699356
1,2,3-tris[(Z)-(2-hydroxy-5-methoxyphenyl)methylideneamino]guanidine (PubChem CID 135699356) has the molecular formula C25H26N6O6 and a molecular weight of 506.52 g/mol. Its IUPAC name is 1,2,3-tris[(Z)-(2-hydroxy-5-methoxyphenyl)methylideneamino]guanidine.
| Compound Name | 1,2,3-tris[(Z)-(2-hydroxy-5-methoxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 135699356 |
| Molecular Formula | C25H26N6O6 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 1,2,3-tris[(Z)-(2-hydroxy-5-methoxyphenyl)methylideneamino]guanidine |
| SMILES | COc1ccc(O)c(/C=N\N=C(N/N=C\c2cc(OC)ccc2O)N/N=C\c2cc(OC)ccc2O)c1 |
| InChI | InChI=1S/C25H26N6O6/c1-35-19-4-7-22(32)16(10-19)13-26-29-25(30-27-14-17-11-20(36-2)5-8-23(17)33)31-28-15-18-12-21(37-3)6-9-24(18)34/h4-15,32-34H,1-3H3,(H2,29,30,31)/b26-13-,27-14-,28-15- |
| InChIKey | NEWALAHUBXETOF-BBROENKCSA-N |
| XLogP | 2.77 |
| TPSA | 161.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|