C20H27N3O3S — CID 135699568
azepan-1-ium;[5-ethoxycarbonyl-4-(furan-2-yl)-6-methyl-2-sulfanylidene-1,4-dihydropyridin-3-ylidene]methylideneazanide (PubChem CID 135699568) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is azepan-1-ium;[5-ethoxycarbonyl-4-(furan-2-yl)-6-methyl-2-sulfanylidene-1,4-dihydropyridin-3-ylidene]methylideneazanide.
| Compound Name | azepan-1-ium;[5-ethoxycarbonyl-4-(furan-2-yl)-6-methyl-2-sulfanylidene-1,4-dihydropyridin-3-ylidene]methylideneazanide |
|---|---|
| PubChem CID | 135699568 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | azepan-1-ium;[5-ethoxycarbonyl-4-(furan-2-yl)-6-methyl-2-sulfanylidene-1,4-dihydropyridin-3-ylidene]methylideneazanide |
| SMILES | C1CCC[NH2+]CC1.CCOC(=O)C1=C(C)NC(=S)C(=C=[N-])C1c1ccco1 |
| InChI | InChI=1S/C14H13N2O3S.C6H13N/c1-3-18-14(17)11-8(2)16-13(20)9(7-15)12(11)10-5-4-6-19-10;1-2-4-6-7-5-3-1/h4-6,12H,3H2,1-2H3,(H,16,20);7H,1-6H2/q-1;/p+1 |
| InChIKey | PRFAOBDFYOOJNF-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|