C20H21ClF3N3O2S — CID 135958603
[4-(3-chlorophenyl)-6-methyl-2-sulfanylidene-5-(trifluoromethoxycarbonyl)-1,4-dihydropyridin-3-ylidene]methylideneazanide;piperidin-1-ium (PubChem CID 135958603) has the molecular formula C20H21ClF3N3O2S and a molecular weight of 459.92 g/mol. Its IUPAC name is [4-(3-chlorophenyl)-6-methyl-2-sulfanylidene-5-(trifluoromethoxycarbonyl)-1,4-dihydropyridin-3-ylidene]methylideneazanide;piperidin-1-ium.
| Compound Name | [4-(3-chlorophenyl)-6-methyl-2-sulfanylidene-5-(trifluoromethoxycarbonyl)-1,4-dihydropyridin-3-ylidene]methylideneazanide;piperidin-1-ium |
|---|---|
| PubChem CID | 135958603 |
| Molecular Formula | C20H21ClF3N3O2S |
| Molecular Weight | 459.92 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | [4-(3-chlorophenyl)-6-methyl-2-sulfanylidene-5-(trifluoromethoxycarbonyl)-1,4-dihydropyridin-3-ylidene]methylideneazanide;piperidin-1-ium |
| SMILES | C1CC[NH2+]CC1.CC1=C(C(=O)OC(F)(F)F)C(c2cccc(Cl)c2)C(=C=[N-])C(=S)N1 |
| InChI | InChI=1S/C15H9ClF3N2O2S.C5H11N/c1-7-11(14(22)23-15(17,18)19)12(10(6-20)13(24)21-7)8-3-2-4-9(16)5-8;1-2-4-6-5-3-1/h2-5,12H,1H3,(H,21,24);6H,1-5H2/q-1;/p+1 |
| InChIKey | BCYRMPSNNHQFMM-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.92 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|