C15H13ClN2OS — CID 176518063
1-[4-(3-chlorophenyl)-5-(iminomethylidene)-2-methyl-6-sulfanylidene-1,4-dihydropyridin-3-yl]ethanone (PubChem CID 176518063) has the molecular formula C15H13ClN2OS and a molecular weight of 304.80 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)-5-(iminomethylidene)-2-methyl-6-sulfanylidene-1,4-dihydropyridin-3-yl]ethanone.
| Compound Name | 1-[4-(3-chlorophenyl)-5-(iminomethylidene)-2-methyl-6-sulfanylidene-1,4-dihydropyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 176518063 |
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 1-[4-(3-chlorophenyl)-5-(iminomethylidene)-2-methyl-6-sulfanylidene-1,4-dihydropyridin-3-yl]ethanone |
| SMILES | CC(=O)C1=C(C)NC(=S)C(=C=N)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13ClN2OS/c1-8-13(9(2)19)14(12(7-17)15(20)18-8)10-4-3-5-11(16)6-10/h3-6,14,17H,1-2H3,(H,18,20) |
| InChIKey | FNQFWHBPQFLDKC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|