C15H12ClNO4-2 — CID 22250345
4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 22250345) has the molecular formula C15H12ClNO4-2 and a molecular weight of 305.72 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 22250345 |
| Molecular Formula | C15H12ClNO4-2 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-(3-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)[O-])C(c2cccc(Cl)c2)C(C(=O)[O-])=C(C)N1 |
| InChI | InChI=1S/C15H14ClNO4/c1-7-11(14(18)19)13(9-4-3-5-10(16)6-9)12(15(20)21)8(2)17-7/h3-6,13,17H,1-2H3,(H,18,19)(H,20,21)/p-2 |
| InChIKey | WAUSHBWWZDZUJK-UHFFFAOYSA-L |
| XLogP | 0.07 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |