C17H20FN5O3S — CID 135700680
N-[4-amino-2-(2-morpholin-4-ylethylsulfanyl)-6-oxo-1H-pyrimidin-5-yl]-2-fluorobenzamide (PubChem CID 135700680) has the molecular formula C17H20FN5O3S and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[4-amino-2-(2-morpholin-4-ylethylsulfanyl)-6-oxo-1H-pyrimidin-5-yl]-2-fluorobenzamide.
| Compound Name | N-[4-amino-2-(2-morpholin-4-ylethylsulfanyl)-6-oxo-1H-pyrimidin-5-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 135700680 |
| Molecular Formula | C17H20FN5O3S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[4-amino-2-(2-morpholin-4-ylethylsulfanyl)-6-oxo-1H-pyrimidin-5-yl]-2-fluorobenzamide |
| SMILES | Nc1nc(SCCN2CCOCC2)[nH]c(=O)c1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H20FN5O3S/c18-12-4-2-1-3-11(12)15(24)20-13-14(19)21-17(22-16(13)25)27-10-7-23-5-8-26-9-6-23/h1-4H,5-10H2,(H,20,24)(H3,19,21,22,25) |
| InChIKey | FNUQCCQWTPZQQX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |