C17H14FN5O2S — CID 135700695
N-[4-amino-6-oxo-2-(pyridin-2-ylmethylsulfanyl)-1H-pyrimidin-5-yl]-2-fluorobenzamide (PubChem CID 135700695) has the molecular formula C17H14FN5O2S and a molecular weight of 371.40 g/mol. Its IUPAC name is N-[4-amino-6-oxo-2-(pyridin-2-ylmethylsulfanyl)-1H-pyrimidin-5-yl]-2-fluorobenzamide.
| Compound Name | N-[4-amino-6-oxo-2-(pyridin-2-ylmethylsulfanyl)-1H-pyrimidin-5-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 135700695 |
| Molecular Formula | C17H14FN5O2S |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[4-amino-6-oxo-2-(pyridin-2-ylmethylsulfanyl)-1H-pyrimidin-5-yl]-2-fluorobenzamide |
| SMILES | Nc1nc(SCc2ccccn2)[nH]c(=O)c1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H14FN5O2S/c18-12-7-2-1-6-11(12)15(24)21-13-14(19)22-17(23-16(13)25)26-9-10-5-3-4-8-20-10/h1-8H,9H2,(H,21,24)(H3,19,22,23,25) |
| InChIKey | XUDVCXAZMSZMKE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |