C19H23NO5 — CID 135702393
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(Z)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxycyclohex-2-en-1-one (PubChem CID 135702393) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(Z)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(Z)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135702393 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(Z)-N-ethoxy-C-ethylcarbonimidoyl]-3-hydroxycyclohex-2-en-1-one |
| SMILES | CCO/N=C(/CC)C1=C(O)CC(c2ccc3c(c2)OCCO3)CC1=O |
| InChI | InChI=1S/C19H23NO5/c1-3-14(20-25-4-2)19-15(21)9-13(10-16(19)22)12-5-6-17-18(11-12)24-8-7-23-17/h5-6,11,13,21H,3-4,7-10H2,1-2H3/b20-14- |
| InChIKey | FQKKKBNBBXILOX-ZHZULCJRSA-N |
| XLogP | 3.52 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|