C25H36BrNO6 — CID 167499469
5-[4-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]phenyl]-3-ethoxy-2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]cyclohex-2-en-1-one (PubChem CID 167499469) has the molecular formula C25H36BrNO6 and a molecular weight of 526.47 g/mol. Its IUPAC name is 5-[4-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]phenyl]-3-ethoxy-2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]cyclohex-2-en-1-one.
| Compound Name | 5-[4-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]phenyl]-3-ethoxy-2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 167499469 |
| Molecular Formula | C25H36BrNO6 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 5-[4-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]phenyl]-3-ethoxy-2-[(E)-N-ethoxy-C-ethylcarbonimidoyl]cyclohex-2-en-1-one |
| SMILES | CCO/N=C(\CC)C1=C(OCC)CC(c2ccc(OCCOCCOCCBr)cc2)CC1=O |
| InChI | InChI=1S/C25H36BrNO6/c1-4-22(27-33-6-3)25-23(28)17-20(18-24(25)31-5-2)19-7-9-21(10-8-19)32-16-15-30-14-13-29-12-11-26/h7-10,20H,4-6,11-18H2,1-3H3/b27-22+ |
| InChIKey | XEVYRZIWOFIMPY-HPNDGRJYSA-N |
| XLogP | 5.03 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|