C23H18FN3O2S — CID 135703022
5-(4-fluorophenyl)-2-(2-phenoxyethylsulfanyl)-4-pyridin-4-yl-1H-pyrimidin-6-one (PubChem CID 135703022) has the molecular formula C23H18FN3O2S and a molecular weight of 419.48 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-(2-phenoxyethylsulfanyl)-4-pyridin-4-yl-1H-pyrimidin-6-one.
| Compound Name | 5-(4-fluorophenyl)-2-(2-phenoxyethylsulfanyl)-4-pyridin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135703022 |
| Molecular Formula | C23H18FN3O2S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 5-(4-fluorophenyl)-2-(2-phenoxyethylsulfanyl)-4-pyridin-4-yl-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(SCCOc2ccccc2)nc(-c2ccncc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H18FN3O2S/c24-18-8-6-16(7-9-18)20-21(17-10-12-25-13-11-17)26-23(27-22(20)28)30-15-14-29-19-4-2-1-3-5-19/h1-13H,14-15H2,(H,26,27,28) |
| InChIKey | CTZFGEUKZGVDSP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|