About quinazolin-7-ol
quinazolin-7-ol (PubChem CID 135703333) has the molecular formula C8H6N2O
and a molecular weight of 146.15 g/mol. Its IUPAC name is quinazolin-7-ol.
Molecular Properties
| Compound Name | quinazolin-7-ol |
| PubChem CID | 135703333 |
| Molecular Formula | C8H6N2O |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | quinazolin-7-ol |
| SMILES | Oc1ccc2cncnc2c1 |
| InChI | InChI=1S/C8H6N2O/c11-7-2-1-6-4-9-5-10-8(6)3-7/h1-5,11H |
| InChIKey | BWDCBBZUYJDNJZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinazolin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinazolin-7-ol?
The IUPAC name of quinazolin-7-ol (CID 135703333) is quinazolin-7-ol.
What is the SMILES notation for quinazolin-7-ol?
The canonical SMILES for quinazolin-7-ol is Oc1ccc2cncnc2c1.
What is the InChIKey of quinazolin-7-ol?
The InChIKey is BWDCBBZUYJDNJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O/c11-7-2-1-6-4-9-5-10-8(6)3-7/h1-5,11H.
What are the key properties of quinazolin-7-ol?
quinazolin-7-ol has a molecular weight of 146.15 g/mol, XLogP of 1.34, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinazolin-7-ol is sourced from PubChem (CID 135703333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).