C19H25N3O5Si — CID 135703983
2-[(4-methoxy-2-nitrophenyl)diazenyl]-5-(3-trimethylsilylpropoxy)phenol (PubChem CID 135703983) has the molecular formula C19H25N3O5Si and a molecular weight of 403.51 g/mol. Its IUPAC name is 2-[(4-methoxy-2-nitrophenyl)diazenyl]-5-(3-trimethylsilylpropoxy)phenol.
| Compound Name | 2-[(4-methoxy-2-nitrophenyl)diazenyl]-5-(3-trimethylsilylpropoxy)phenol |
|---|---|
| PubChem CID | 135703983 |
| Molecular Formula | C19H25N3O5Si |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-[(4-methoxy-2-nitrophenyl)diazenyl]-5-(3-trimethylsilylpropoxy)phenol |
| SMILES | COc1ccc(/N=N/c2ccc(OCCC[Si](C)(C)C)cc2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H25N3O5Si/c1-26-14-6-8-16(18(12-14)22(24)25)20-21-17-9-7-15(13-19(17)23)27-10-5-11-28(2,3)4/h6-9,12-13,23H,5,10-11H2,1-4H3/b21-20+ |
| InChIKey | NFQDXPVODRHPPZ-QZQOTICOSA-N |
| XLogP | 5.83 |
| TPSA | 106.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|