C18H25N3O2S — CID 135704799
2-[(5R)-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methylbutyl)acetamide (PubChem CID 135704799) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-[(5R)-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methylbutyl)acetamide.
| Compound Name | 2-[(5R)-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 135704799 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-[(5R)-2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methylbutyl)acetamide |
| SMILES | Cc1cc(C)cc(/N=C2/NC(=O)[C@@H](CC(=O)NCCC(C)C)S2)c1 |
| InChI | InChI=1S/C18H25N3O2S/c1-11(2)5-6-19-16(22)10-15-17(23)21-18(24-15)20-14-8-12(3)7-13(4)9-14/h7-9,11,15H,5-6,10H2,1-4H3,(H,19,22)(H,20,21,23)/t15-/m1/s1 |
| InChIKey | SHZMWJQNNRAWEG-OAHLLOKOSA-N |
| XLogP | 3.07 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|