C23H27N3O4S — CID 135441909
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135441909) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135441909 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CC2S/C(=N\c3cc(C)cc(C)c3)NC2=O)cc1OC |
| InChI | InChI=1S/C23H27N3O4S/c1-14-9-15(2)11-17(10-14)25-23-26-22(28)20(31-23)13-21(27)24-8-7-16-5-6-18(29-3)19(12-16)30-4/h5-6,9-12,20H,7-8,13H2,1-4H3,(H,24,27)(H,25,26,28) |
| InChIKey | JXPOPAOMPJLOQR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|