C22H25N3O3S — CID 135706427
2-[[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-ylidene]amino]-N-(1-phenylethyl)acetamide (PubChem CID 135706427) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-ylidene]amino]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-ylidene]amino]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 135706427 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-[[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-ylidene]amino]-N-(1-phenylethyl)acetamide |
| SMILES | CCC1=C(c2ccc(C)cc2)S(=O)(=O)N/C1=N\CC(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-4-19-21(18-12-10-15(2)11-13-18)29(27,28)25-22(19)23-14-20(26)24-16(3)17-8-6-5-7-9-17/h5-13,16H,4,14H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | OKDISGJPIUTXAI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|