C15H16N4O3 — CID 135708304
4-[(Z)-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]benzoic acid (PubChem CID 135708304) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 4-[(Z)-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[(Z)-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 135708304 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 4-[(Z)-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]benzoic acid |
| SMILES | CCCc1cc(=O)[nH]c(N/N=C\c2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C15H16N4O3/c1-2-3-12-8-13(20)18-15(17-12)19-16-9-10-4-6-11(7-5-10)14(21)22/h4-9H,2-3H2,1H3,(H,21,22)(H2,17,18,19,20)/b16-9- |
| InChIKey | QRJRHHJPRGGCRS-SXGWCWSVSA-N |
| XLogP | 1.87 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|