C21H20ClFN4O2 — CID 136733347
2-[(2E)-2-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-propyl-1H-pyrimidin-6-one (PubChem CID 136733347) has the molecular formula C21H20ClFN4O2 and a molecular weight of 414.87 g/mol. Its IUPAC name is 2-[(2E)-2-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2E)-2-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136733347 |
| Molecular Formula | C21H20ClFN4O2 |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-[(2E)-2-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylidene]hydrazinyl]-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1cc(=O)[nH]c(N/N=C/c2ccc(OCc3c(F)cccc3Cl)cc2)n1 |
| InChI | InChI=1S/C21H20ClFN4O2/c1-2-4-15-11-20(28)26-21(25-15)27-24-12-14-7-9-16(10-8-14)29-13-17-18(22)5-3-6-19(17)23/h3,5-12H,2,4,13H2,1H3,(H2,25,26,27,28)/b24-12+ |
| InChIKey | PHBWAIVQTRFZJZ-WYMPLXKRSA-N |
| XLogP | 4.54 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|