C21H15ClF4N2O — CID 110841537
N-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]-3-(trifluoromethyl)aniline (PubChem CID 110841537) has the molecular formula C21H15ClF4N2O and a molecular weight of 422.81 g/mol. Its IUPAC name is N-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]-3-(trifluoromethyl)aniline.
| Compound Name | N-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 110841537 |
| Molecular Formula | C21H15ClF4N2O |
| Molecular Weight | 422.81 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | N-[[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]-3-(trifluoromethyl)aniline |
| SMILES | Fc1cccc(Cl)c1COc1ccc(C=NNc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H15ClF4N2O/c22-19-5-2-6-20(23)18(19)13-29-17-9-7-14(8-10-17)12-27-28-16-4-1-3-15(11-16)21(24,25)26/h1-12,28H,13H2 |
| InChIKey | AQFCCIPOMRAIIN-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.81 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|