C24H21ClFN7O — CID 46495426
2-N-[(E)-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]-6-N-methyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 46495426) has the molecular formula C24H21ClFN7O and a molecular weight of 477.93 g/mol. Its IUPAC name is 2-N-[(E)-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]-6-N-methyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(E)-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]-6-N-methyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 46495426 |
| Molecular Formula | C24H21ClFN7O |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-N-[(E)-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methylideneamino]-6-N-methyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(N/N=C/c2ccc(OCc3c(F)cccc3Cl)cc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C24H21ClFN7O/c1-27-22-30-23(29-17-6-3-2-4-7-17)32-24(31-22)33-28-14-16-10-12-18(13-11-16)34-15-19-20(25)8-5-9-21(19)26/h2-14H,15H2,1H3,(H3,27,29,30,31,32,33)/b28-14+ |
| InChIKey | CGSPZBIPGBQUMY-CCVNUDIWSA-N |
| XLogP | 5.47 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|