C14H14FN5O — CID 135708892
7-[(2-fluorophenyl)methyl]-2-(methylaminomethyl)-1H-purin-6-one (PubChem CID 135708892) has the molecular formula C14H14FN5O and a molecular weight of 287.30 g/mol. Its IUPAC name is 7-[(2-fluorophenyl)methyl]-2-(methylaminomethyl)-1H-purin-6-one.
| Compound Name | 7-[(2-fluorophenyl)methyl]-2-(methylaminomethyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135708892 |
| Molecular Formula | C14H14FN5O |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 7-[(2-fluorophenyl)methyl]-2-(methylaminomethyl)-1H-purin-6-one |
| SMILES | CNCc1nc2ncn(Cc3ccccc3F)c2c(=O)[nH]1 |
| InChI | InChI=1S/C14H14FN5O/c1-16-6-11-18-13-12(14(21)19-11)20(8-17-13)7-9-4-2-3-5-10(9)15/h2-5,8,16H,6-7H2,1H3,(H,18,19,21) |
| InChIKey | RYBJBZQUDSJCEI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |