C14H9N5O2S — CID 135710061
(2Z)-1-hydroxy-N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-3-oxoindene-2-carboximidoyl cyanide (PubChem CID 135710061) has the molecular formula C14H9N5O2S and a molecular weight of 311.33 g/mol. Its IUPAC name is (2Z)-1-hydroxy-N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-3-oxoindene-2-carboximidoyl cyanide.
| Compound Name | (2Z)-1-hydroxy-N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-3-oxoindene-2-carboximidoyl cyanide |
|---|---|
| PubChem CID | 135710061 |
| Molecular Formula | C14H9N5O2S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (2Z)-1-hydroxy-N-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)-3-oxoindene-2-carboximidoyl cyanide |
| SMILES | CSc1n[nH]c(/N=C(\C#N)C2=C(O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C14H9N5O2S/c1-22-14-17-13(18-19-14)16-9(6-15)10-11(20)7-4-2-3-5-8(7)12(10)21/h2-5,20H,1H3,(H,17,18,19)/b16-9+ |
| InChIKey | ROLFPURFOVHBDX-CXUHLZMHSA-N |
| XLogP | 2.29 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|