C21H15Cl2N3OS — CID 135712126
(2E)-5-[(2,4-dichlorophenyl)methyl]-2-[(E)-naphthalen-1-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135712126) has the molecular formula C21H15Cl2N3OS and a molecular weight of 428.34 g/mol. Its IUPAC name is (2E)-5-[(2,4-dichlorophenyl)methyl]-2-[(E)-naphthalen-1-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[(2,4-dichlorophenyl)methyl]-2-[(E)-naphthalen-1-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135712126 |
| Molecular Formula | C21H15Cl2N3OS |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | (2E)-5-[(2,4-dichlorophenyl)methyl]-2-[(E)-naphthalen-1-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=C\c2cccc3ccccc23)SC1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H15Cl2N3OS/c22-16-9-8-14(18(23)11-16)10-19-20(27)25-21(28-19)26-24-12-15-6-3-5-13-4-1-2-7-17(13)15/h1-9,11-12,19H,10H2,(H,25,26,27)/b24-12+ |
| InChIKey | KQDUPOCLJZSIMF-WYMPLXKRSA-N |
| XLogP | 5.31 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|