C23H28N2O — CID 135712842
(2R)-N-benzyl-7-cyano-2-ethyl-N-phenylheptanamide (PubChem CID 135712842) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is (2R)-N-benzyl-7-cyano-2-ethyl-N-phenylheptanamide.
| Compound Name | (2R)-N-benzyl-7-cyano-2-ethyl-N-phenylheptanamide |
|---|---|
| PubChem CID | 135712842 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | (2R)-N-benzyl-7-cyano-2-ethyl-N-phenylheptanamide |
| SMILES | CC[C@H](CCCCCC#N)C(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O/c1-2-21(15-9-3-4-12-18-24)23(26)25(22-16-10-6-11-17-22)19-20-13-7-5-8-14-20/h5-8,10-11,13-14,16-17,21H,2-4,9,12,15,19H2,1H3/t21-/m1/s1 |
| InChIKey | IVYIKQONTVCLEI-OAQYLSRUSA-N |
| XLogP | 5.72 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|