About N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium
N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium (PubChem CID 91434931) has the molecular formula C23H35N2O+
and a molecular weight of 355.55 g/mol. Its IUPAC name is N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium |
| PubChem CID | 91434931 |
| Molecular Formula | C23H35N2O+ |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium |
| SMILES | CCC(C)C(=O)N(Cc1ccccc1)c1ccccc1.CC[N+](C)(C)C |
| InChI | InChI=1S/C18H21NO.C5H14N/c1-3-15(2)18(20)19(17-12-8-5-9-13-17)14-16-10-6-4-7-11-16;1-5-6(2,3)4/h4-13,15H,3,14H2,1-2H3;5H2,1-4H3/q;+1 |
| InChIKey | JPKRGHVGYMRHBU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium?
The IUPAC name of N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium (CID 91434931) is N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium.
What is the SMILES notation for N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium?
The canonical SMILES for N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium is CCC(C)C(=O)N(Cc1ccccc1)c1ccccc1.CC[N+](C)(C)C.
What is the InChIKey of N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium?
The InChIKey is JPKRGHVGYMRHBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO.C5H14N/c1-3-15(2)18(20)19(17-12-8-5-9-13-17)14-16-10-6-4-7-11-16;1-5-6(2,3)4/h4-13,15H,3,14H2,1-2H3;5H2,1-4H3/q;+1.
What are the key properties of N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium?
N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium has a molecular weight of 355.55 g/mol, XLogP of 4.98, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-methyl-N-phenylbutanamide;ethyl(trimethyl)azanium is sourced from PubChem (CID 91434931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).