About 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea
1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea (PubChem CID 135716318) has the molecular formula C15H15N3O3S
and a molecular weight of 317.37 g/mol. Its IUPAC name is 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea.
Molecular Properties
| Compound Name | 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea |
| PubChem CID | 135716318 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)N/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C15H15N3O3S/c1-21-14-5-3-2-4-12(14)17-15(22)18-16-9-10-6-7-11(19)8-13(10)20/h2-9,19-20H,1H3,(H2,17,18,22)/b16-9+ |
| InChIKey | DDGWIZQYKOLKGO-CXUHLZMHSA-N |
| XLogP | 2.43 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea?
The IUPAC name of 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea (CID 135716318) is 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea.
What is the SMILES notation for 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea?
The canonical SMILES for 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea is COc1ccccc1NC(=S)N/N=C/c1ccc(O)cc1O.
What is the InChIKey of 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea?
The InChIKey is DDGWIZQYKOLKGO-CXUHLZMHSA-N. The full InChI is InChI=1S/C15H15N3O3S/c1-21-14-5-3-2-4-12(14)17-15(22)18-16-9-10-6-7-11(19)8-13(10)20/h2-9,19-20H,1H3,(H2,17,18,22)/b16-9+.
What are the key properties of 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea?
1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea has a molecular weight of 317.37 g/mol, XLogP of 2.43, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-3-(2-methoxyphenyl)thiourea is sourced from PubChem (CID 135716318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).