C17H15BrFN3O3 — CID 135716679
N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide (PubChem CID 135716679) has the molecular formula C17H15BrFN3O3 and a molecular weight of 408.23 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide |
|---|---|
| PubChem CID | 135716679 |
| Molecular Formula | C17H15BrFN3O3 |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-N'-(2-fluorophenyl)-2-methylpropanediamide |
| SMILES | CC(C(=O)N/N=C/c1cc(Br)ccc1O)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C17H15BrFN3O3/c1-10(16(24)21-14-5-3-2-4-13(14)19)17(25)22-20-9-11-8-12(18)6-7-15(11)23/h2-10,23H,1H3,(H,21,24)(H,22,25)/b20-9+ |
| InChIKey | PEZFTFYOUOTWJL-AWQFTUOYSA-N |
| XLogP | 3.02 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|