C14H14ClN5O3S — CID 135718615
N'-[2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoyl]-3-chlorobenzohydrazide (PubChem CID 135718615) has the molecular formula C14H14ClN5O3S and a molecular weight of 367.82 g/mol. Its IUPAC name is N'-[2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoyl]-3-chlorobenzohydrazide.
| Compound Name | N'-[2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoyl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 135718615 |
| Molecular Formula | C14H14ClN5O3S |
| Molecular Weight | 367.82 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | N'-[2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]propanoyl]-3-chlorobenzohydrazide |
| SMILES | CC(Sc1nc(N)cc(=O)[nH]1)C(=O)NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H14ClN5O3S/c1-7(24-14-17-10(16)6-11(21)18-14)12(22)19-20-13(23)8-3-2-4-9(15)5-8/h2-7H,1H3,(H,19,22)(H,20,23)(H3,16,17,18,21) |
| InChIKey | NBMFLMXKMZPDGT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.82 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|