C13H12ClN3O2S — CID 135788231
4-amino-2-[(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 135788231) has the molecular formula C13H12ClN3O2S and a molecular weight of 309.78 g/mol. Its IUPAC name is 4-amino-2-[(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135788231 |
| Molecular Formula | C13H12ClN3O2S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 4-amino-2-[(2R)-1-(4-chlorophenyl)-1-oxopropan-2-yl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | C[C@@H](Sc1nc(N)cc(=O)[nH]1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H12ClN3O2S/c1-7(12(19)8-2-4-9(14)5-3-8)20-13-16-10(15)6-11(18)17-13/h2-7H,1H3,(H3,15,16,17,18)/t7-/m1/s1 |
| InChIKey | AODPBODBIRSTCF-SSDOTTSWSA-N |
| XLogP | 2.37 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |