C16H16N4O2S — CID 135739724
4-amino-2-[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 135739724) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is 4-amino-2-[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135739724 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 4-amino-2-[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)[C@H](C)Sc1nc(N)cc(=O)[nH]1 |
| InChI | InChI=1S/C16H16N4O2S/c1-8-14(10-5-3-4-6-11(10)18-8)15(22)9(2)23-16-19-12(17)7-13(21)20-16/h3-7,9,18H,1-2H3,(H3,17,19,20,21)/t9-/m0/s1 |
| InChIKey | YFKZIRUSCGKWQF-VIFPVBQESA-N |
| XLogP | 2.51 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |