About 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum
4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum (PubChem CID 135723126) has the molecular formula C19H17N3O2Pt
and a molecular weight of 514.44 g/mol. Its IUPAC name is 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum.
Molecular Properties
| Compound Name | 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum |
| PubChem CID | 135723126 |
| Molecular Formula | C19H17N3O2Pt |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum |
| SMILES | C=Cc1ccncc1.Oc1ccccc1/N=N/c1ccccc1O.[Pt] |
| InChI | InChI=1S/C12H10N2O2.C7H7N.Pt/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16;1-2-7-3-5-8-6-4-7;/h1-8,15-16H;2-6H,1H2;/b14-13+;; |
| InChIKey | BHOBGDVMNXNENB-QDBORUFSSA-N |
| XLogP | 5.24 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum?
The IUPAC name of 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum (CID 135723126) is 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum.
What is the SMILES notation for 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum?
The canonical SMILES for 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum is C=Cc1ccncc1.Oc1ccccc1/N=N/c1ccccc1O.[Pt].
What is the InChIKey of 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum?
The InChIKey is BHOBGDVMNXNENB-QDBORUFSSA-N. The full InChI is InChI=1S/C12H10N2O2.C7H7N.Pt/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16;1-2-7-3-5-8-6-4-7;/h1-8,15-16H;2-6H,1H2;/b14-13+;;.
What are the key properties of 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum?
4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum has a molecular weight of 514.44 g/mol, XLogP of 5.24, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylpyridine;2-[(2-hydroxyphenyl)diazenyl]phenol;platinum is sourced from PubChem (CID 135723126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).