C23H21N3O4 — CID 135723646
(8-methyl-4-oxo-3H-quinazolin-2-yl)methyl 2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]acetate (PubChem CID 135723646) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is (8-methyl-4-oxo-3H-quinazolin-2-yl)methyl 2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]acetate.
| Compound Name | (8-methyl-4-oxo-3H-quinazolin-2-yl)methyl 2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]acetate |
|---|---|
| PubChem CID | 135723646 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (8-methyl-4-oxo-3H-quinazolin-2-yl)methyl 2-[(1S)-2-acetyl-1H-isoquinolin-1-yl]acetate |
| SMILES | CC(=O)N1C=Cc2ccccc2[C@@H]1CC(=O)OCc1nc2c(C)cccc2c(=O)[nH]1 |
| InChI | InChI=1S/C23H21N3O4/c1-14-6-5-9-18-22(14)24-20(25-23(18)29)13-30-21(28)12-19-17-8-4-3-7-16(17)10-11-26(19)15(2)27/h3-11,19H,12-13H2,1-2H3,(H,24,25,29)/t19-/m0/s1 |
| InChIKey | UDRIXCQIAOLEJK-IBGZPJMESA-N |
| XLogP | 3.24 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |