C21H26N6O — CID 135723938
(4E)-4-[[3-cyclobutyl-4-[2-(ethylamino)ethyl]-5-methyl-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one (PubChem CID 135723938) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is (4E)-4-[[3-cyclobutyl-4-[2-(ethylamino)ethyl]-5-methyl-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one.
| Compound Name | (4E)-4-[[3-cyclobutyl-4-[2-(ethylamino)ethyl]-5-methyl-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135723938 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (4E)-4-[[3-cyclobutyl-4-[2-(ethylamino)ethyl]-5-methyl-1H-pyrrol-2-yl]methylidene]-3-pyrazin-2-yl-1H-pyrazol-5-one |
| SMILES | CCNCCc1c(C)[nH]c(/C=C2/C(=O)NN=C2c2cnccn2)c1C1CCC1 |
| InChI | InChI=1S/C21H26N6O/c1-3-22-8-7-15-13(2)25-17(19(15)14-5-4-6-14)11-16-20(26-27-21(16)28)18-12-23-9-10-24-18/h9-12,14,22,25H,3-8H2,1-2H3,(H,27,28)/b16-11+ |
| InChIKey | VPDQXSUSYWHPDZ-LFIBNONCSA-N |
| XLogP | 2.45 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|