C18H24N4O4 — CID 135724087
2-(dimethylamino)ethyl 5-[(E)-(3-cyclopropyloxy-5-oxo-1H-pyrazol-4-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 135724087) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 5-[(E)-(3-cyclopropyloxy-5-oxo-1H-pyrazol-4-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | 2-(dimethylamino)ethyl 5-[(E)-(3-cyclopropyloxy-5-oxo-1H-pyrazol-4-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 135724087 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-(dimethylamino)ethyl 5-[(E)-(3-cyclopropyloxy-5-oxo-1H-pyrazol-4-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | Cc1[nH]c(/C=C2/C(=O)NN=C2OC2CC2)c(C)c1C(=O)OCCN(C)C |
| InChI | InChI=1S/C18H24N4O4/c1-10-14(9-13-16(23)20-21-17(13)26-12-5-6-12)19-11(2)15(10)18(24)25-8-7-22(3)4/h9,12,19H,5-8H2,1-4H3,(H,20,23)/b13-9- |
| InChIKey | PFDYRIXTHPRNLE-LCYFTJDESA-N |
| XLogP | 1.36 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|