C17H19N3O6 — CID 135724116
diethyl 2-[(E)-(3-cyclopropyloxy-5-oxo-1H-pyrazol-4-ylidene)methyl]-1H-pyrrole-3,4-dicarboxylate (PubChem CID 135724116) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is diethyl 2-[(E)-(3-cyclopropyloxy-5-oxo-1H-pyrazol-4-ylidene)methyl]-1H-pyrrole-3,4-dicarboxylate.
| Compound Name | diethyl 2-[(E)-(3-cyclopropyloxy-5-oxo-1H-pyrazol-4-ylidene)methyl]-1H-pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 135724116 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | diethyl 2-[(E)-(3-cyclopropyloxy-5-oxo-1H-pyrazol-4-ylidene)methyl]-1H-pyrrole-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c[nH]c(/C=C2/C(=O)NN=C2OC2CC2)c1C(=O)OCC |
| InChI | InChI=1S/C17H19N3O6/c1-3-24-16(22)11-8-18-12(13(11)17(23)25-4-2)7-10-14(21)19-20-15(10)26-9-5-6-9/h7-9,18H,3-6H2,1-2H3,(H,19,21)/b10-7- |
| InChIKey | SPUSHKMRZVUUIW-YFHOEESVSA-N |
| XLogP | 1.37 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|