C22H24N4O5 — CID 152762873
diethyl 2-[[3-[2-(4-aminophenyl)ethyl]-5-oxo-1H-pyrazol-4-ylidene]methyl]-1H-pyrrole-3,4-dicarboxylate (PubChem CID 152762873) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is diethyl 2-[[3-[2-(4-aminophenyl)ethyl]-5-oxo-1H-pyrazol-4-ylidene]methyl]-1H-pyrrole-3,4-dicarboxylate.
| Compound Name | diethyl 2-[[3-[2-(4-aminophenyl)ethyl]-5-oxo-1H-pyrazol-4-ylidene]methyl]-1H-pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 152762873 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | diethyl 2-[[3-[2-(4-aminophenyl)ethyl]-5-oxo-1H-pyrazol-4-ylidene]methyl]-1H-pyrrole-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c[nH]c(C=C2C(=O)NN=C2CCc2ccc(N)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C22H24N4O5/c1-3-30-21(28)16-12-24-18(19(16)22(29)31-4-2)11-15-17(25-26-20(15)27)10-7-13-5-8-14(23)9-6-13/h5-6,8-9,11-12,24H,3-4,7,10,23H2,1-2H3,(H,26,27) |
| InChIKey | QIYXPNXOELCGCZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|