C14H16FN3O2 — CID 121305827
ethyl 5-amino-1-[2-(4-fluorophenyl)ethyl]pyrazole-4-carboxylate (PubChem CID 121305827) has the molecular formula C14H16FN3O2 and a molecular weight of 277.30 g/mol. Its IUPAC name is ethyl 5-amino-1-[2-(4-fluorophenyl)ethyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-[2-(4-fluorophenyl)ethyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 121305827 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | ethyl 5-amino-1-[2-(4-fluorophenyl)ethyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(CCc2ccc(F)cc2)c1N |
| InChI | InChI=1S/C14H16FN3O2/c1-2-20-14(19)12-9-17-18(13(12)16)8-7-10-3-5-11(15)6-4-10/h3-6,9H,2,7-8,16H2,1H3 |
| InChIKey | XTLWHYABTLTSEB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |