C14H16ClN3O3 — CID 23655881
ethyl 5-amino-1-[2-(4-chlorophenyl)-2-hydroxyethyl]pyrazole-4-carboxylate (PubChem CID 23655881) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is ethyl 5-amino-1-[2-(4-chlorophenyl)-2-hydroxyethyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-[2-(4-chlorophenyl)-2-hydroxyethyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 23655881 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | ethyl 5-amino-1-[2-(4-chlorophenyl)-2-hydroxyethyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(CC(O)c2ccc(Cl)cc2)c1N |
| InChI | InChI=1S/C14H16ClN3O3/c1-2-21-14(20)11-7-17-18(13(11)16)8-12(19)9-3-5-10(15)6-4-9/h3-7,12,19H,2,8,16H2,1H3 |
| InChIKey | VBCZFWVYXJUURZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |