C10H17N3O2 — CID 43145818
ethyl 5-amino-1-(2-methylpropyl)pyrazole-4-carboxylate (PubChem CID 43145818) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl 5-amino-1-(2-methylpropyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-(2-methylpropyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 43145818 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | ethyl 5-amino-1-(2-methylpropyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(CC(C)C)c1N |
| InChI | InChI=1S/C10H17N3O2/c1-4-15-10(14)8-5-12-13(9(8)11)6-7(2)3/h5,7H,4,6,11H2,1-3H3 |
| InChIKey | UPNNOXRELXOKAQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |