C13H21N2NaO5 — CID 159056664
sodium;diethyl 1-ethylpyrazole-4,5-dicarboxylate;ethanolate (PubChem CID 159056664) has the molecular formula C13H21N2NaO5 and a molecular weight of 308.31 g/mol. Its IUPAC name is sodium;diethyl 1-ethylpyrazole-4,5-dicarboxylate;ethanolate.
| Compound Name | sodium;diethyl 1-ethylpyrazole-4,5-dicarboxylate;ethanolate |
|---|---|
| PubChem CID | 159056664 |
| Molecular Formula | C13H21N2NaO5 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | sodium;diethyl 1-ethylpyrazole-4,5-dicarboxylate;ethanolate |
| SMILES | CCOC(=O)c1cnn(CC)c1C(=O)OCC.CC[O-].[Na+] |
| InChI | InChI=1S/C11H16N2O4.C2H5O.Na/c1-4-13-9(11(15)17-6-3)8(7-12-13)10(14)16-5-2;1-2-3;/h7H,4-6H2,1-3H3;2H2,1H3;/q;-1;+1 |
| InChIKey | JXYFAYFJURGKEJ-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 93.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |