C9H13N3O2S — CID 58127856
ethyl 1-(2-amino-2-sulfanylideneethyl)-5-methylpyrazole-4-carboxylate (PubChem CID 58127856) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is ethyl 1-(2-amino-2-sulfanylideneethyl)-5-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 1-(2-amino-2-sulfanylideneethyl)-5-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 58127856 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | ethyl 1-(2-amino-2-sulfanylideneethyl)-5-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(CC(N)=S)c1C |
| InChI | InChI=1S/C9H13N3O2S/c1-3-14-9(13)7-4-11-12(6(7)2)5-8(10)15/h4H,3,5H2,1-2H3,(H2,10,15) |
| InChIKey | KFXQDZUVXXIGMT-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|