C11H14NO2S- — CID 135724718
6-[carboxy(methyl)amino]-2,3,4-trimethylbenzenethiolate (PubChem CID 135724718) has the molecular formula C11H14NO2S- and a molecular weight of 224.30 g/mol. Its IUPAC name is 6-[carboxy(methyl)amino]-2,3,4-trimethylbenzenethiolate.
| Compound Name | 6-[carboxy(methyl)amino]-2,3,4-trimethylbenzenethiolate |
|---|---|
| PubChem CID | 135724718 |
| Molecular Formula | C11H14NO2S- |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 6-[carboxy(methyl)amino]-2,3,4-trimethylbenzenethiolate |
| SMILES | Cc1cc(N(C)C(=O)O)c([S-])c(C)c1C |
| InChI | InChI=1S/C11H15NO2S/c1-6-5-9(12(4)11(13)14)10(15)8(3)7(6)2/h5,15H,1-4H3,(H,13,14)/p-1 |
| InChIKey | WUKWDBHYIGTOOQ-UHFFFAOYSA-M |
| XLogP | 2.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|