About S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride
S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride (PubChem CID 135727024) has the molecular formula C14H15ClN4O2S
and a molecular weight of 338.82 g/mol. Its IUPAC name is S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride.
Molecular Properties
| Compound Name | S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride |
| PubChem CID | 135727024 |
| Molecular Formula | C14H15ClN4O2S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride |
| SMILES | C[n+]1cccc(O)c1/C=N/NC(=O)SNc1ccccc1.[Cl-] |
| InChI | InChI=1S/C14H14N4O2S.ClH/c1-18-9-5-8-13(19)12(18)10-15-16-14(20)21-17-11-6-3-2-4-7-11;/h2-10,17,19H,1H3;1H |
| InChIKey | LFTHKJKWMIZBOK-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 77.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride?
The IUPAC name of S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride (CID 135727024) is S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride.
What is the SMILES notation for S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride?
The canonical SMILES for S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride is C[n+]1cccc(O)c1/C=N/NC(=O)SNc1ccccc1.[Cl-].
What is the InChIKey of S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride?
The InChIKey is LFTHKJKWMIZBOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O2S.ClH/c1-18-9-5-8-13(19)12(18)10-15-16-14(20)21-17-11-6-3-2-4-7-11;/h2-10,17,19H,1H3;1H.
What are the key properties of S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride?
S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride has a molecular weight of 338.82 g/mol, XLogP of -0.98, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-anilino N-[(E)-(3-hydroxy-1-methylpyridin-1-ium-2-yl)methylideneamino]carbamothioate chloride is sourced from PubChem (CID 135727024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).