C11H8F3N3O — CID 135727209
2-anilino-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 135727209) has the molecular formula C11H8F3N3O and a molecular weight of 255.20 g/mol. Its IUPAC name is 2-anilino-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-anilino-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135727209 |
| Molecular Formula | C11H8F3N3O |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 2-anilino-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(C(F)(F)F)nc(Nc2ccccc2)[nH]1 |
| InChI | InChI=1S/C11H8F3N3O/c12-11(13,14)8-6-9(18)17-10(16-8)15-7-4-2-1-3-5-7/h1-6H,(H2,15,16,17,18) |
| InChIKey | JOHZVKVOKACSTI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |