C20H16ClN3O3S — CID 135729983
(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 4-(1,3-benzothiazol-2-yl)butanoate (PubChem CID 135729983) has the molecular formula C20H16ClN3O3S and a molecular weight of 413.89 g/mol. Its IUPAC name is (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 4-(1,3-benzothiazol-2-yl)butanoate.
| Compound Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 4-(1,3-benzothiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 135729983 |
| Molecular Formula | C20H16ClN3O3S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | (7-chloro-4-oxo-3H-quinazolin-2-yl)methyl 4-(1,3-benzothiazol-2-yl)butanoate |
| SMILES | O=C(CCCc1nc2ccccc2s1)OCc1nc2cc(Cl)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H16ClN3O3S/c21-12-8-9-13-15(10-12)22-17(24-20(13)26)11-27-19(25)7-3-6-18-23-14-4-1-2-5-16(14)28-18/h1-2,4-5,8-10H,3,6-7,11H2,(H,22,24,26) |
| InChIKey | UMARFYFOTWPEGW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |